C8H13NOS — CID 83816303
1,3,4,4a,5,7,8,8a-octahydrothiopyrano[4,3-b]pyridin-2-one (PubChem CID 83816303) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 1,3,4,4a,5,7,8,8a-octahydrothiopyrano[4,3-b]pyridin-2-one.
| Compound Name | 1,3,4,4a,5,7,8,8a-octahydrothiopyrano[4,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 83816303 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1,3,4,4a,5,7,8,8a-octahydrothiopyrano[4,3-b]pyridin-2-one |
| SMILES | O=C1CCC2CSCCC2N1 |
| InChI | InChI=1S/C8H13NOS/c10-8-2-1-6-5-11-4-3-7(6)9-8/h6-7H,1-5H2,(H,9,10) |
| InChIKey | MMTORKQWZBTGOO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |