C8H13BrN2O — CID 174453871
6-bromo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 174453871) has the molecular formula C8H13BrN2O and a molecular weight of 233.11 g/mol. Its IUPAC name is 6-bromo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-bromo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 174453871 |
| Molecular Formula | C8H13BrN2O |
| Molecular Weight | 233.11 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 6-bromo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | O=C1CCC2CN(Br)CCC2N1 |
| InChI | InChI=1S/C8H13BrN2O/c9-11-4-3-7-6(5-11)1-2-8(12)10-7/h6-7H,1-5H2,(H,10,12) |
| InChIKey | XRLVAUKTCYFDFR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.11 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|