C7H13NOS — CID 144857343
3,4,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyridin-2-one;molecular hydrogen (PubChem CID 144857343) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is 3,4,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyridin-2-one;molecular hydrogen.
| Compound Name | 3,4,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyridin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 144857343 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 3,4,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyridin-2-one;molecular hydrogen |
| SMILES | O=C1CCC2CSCC2N1.[H][H] |
| InChI | InChI=1S/C7H11NOS.H2/c9-7-2-1-5-3-10-4-6(5)8-7;/h5-6H,1-4H2,(H,8,9);1H |
| InChIKey | HGODTJLQFFNIGK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |