C8H14N2O — CID 82416611
(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one (PubChem CID 82416611) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 82416611 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CCNC[C@H]2N1 |
| InChI | InChI=1S/C8H14N2O/c11-8-2-1-6-3-4-9-5-7(6)10-8/h6-7,9H,1-5H2,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | PENQRHZZBAMZLK-RNFRBKRXSA-N |
| XLogP | -0.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |