C8H12ClN3S — CID 107132534
4-chloro-1-(thiolan-3-ylmethyl)pyrazol-5-amine (PubChem CID 107132534) has the molecular formula C8H12ClN3S and a molecular weight of 217.72 g/mol. Its IUPAC name is 4-chloro-1-(thiolan-3-ylmethyl)pyrazol-5-amine.
| Compound Name | 4-chloro-1-(thiolan-3-ylmethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 107132534 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 4-chloro-1-(thiolan-3-ylmethyl)pyrazol-5-amine |
| SMILES | Nc1c(Cl)cnn1CC1CCSC1 |
| InChI | InChI=1S/C8H12ClN3S/c9-7-3-11-12(8(7)10)4-6-1-2-13-5-6/h3,6H,1-2,4-5,10H2 |
| InChIKey | JWRARUSEABBWHE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |