C13H16ClN5 — CID 146187702
6-chloro-1-[(4-methylidenecyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 146187702) has the molecular formula C13H16ClN5 and a molecular weight of 277.76 g/mol. Its IUPAC name is 6-chloro-1-[(4-methylidenecyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-1-[(4-methylidenecyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146187702 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 6-chloro-1-[(4-methylidenecyclohexyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=C1CCC(Cn2ncc3c(N)nc(Cl)nc32)CC1 |
| InChI | InChI=1S/C13H16ClN5/c1-8-2-4-9(5-3-8)7-19-12-10(6-16-19)11(15)17-13(14)18-12/h6,9H,1-5,7H2,(H2,15,17,18) |
| InChIKey | JCJDTXSXYBSFRL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|