C10H21N3 — CID 170393204
(4S)-1,4,5,5,6,6-hexamethyl-4H-pyrimidin-2-amine (PubChem CID 170393204) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is (4S)-1,4,5,5,6,6-hexamethyl-4H-pyrimidin-2-amine.
| Compound Name | (4S)-1,4,5,5,6,6-hexamethyl-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 170393204 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | (4S)-1,4,5,5,6,6-hexamethyl-4H-pyrimidin-2-amine |
| SMILES | C[C@@H]1N=C(N)N(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C10H21N3/c1-7-9(2,3)10(4,5)13(6)8(11)12-7/h7H,1-6H3,(H2,11,12)/t7-/m0/s1 |
| InChIKey | AUZCRYZKISKWKW-ZETCQYMHSA-N |
| XLogP | 1.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |