C9H11N3 — CID 176540475
7-methyl-4a,8a-dihydro-3H-quinazolin-4-imine (PubChem CID 176540475) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 7-methyl-4a,8a-dihydro-3H-quinazolin-4-imine.
| Compound Name | 7-methyl-4a,8a-dihydro-3H-quinazolin-4-imine |
|---|---|
| PubChem CID | 176540475 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 7-methyl-4a,8a-dihydro-3H-quinazolin-4-imine |
| SMILES | [H]/N=C1\NC=NC2C=C(C)C=CC12 |
| InChI | InChI=1S/C9H11N3/c1-6-2-3-7-8(4-6)11-5-12-9(7)10/h2-5,7-8H,1H3,(H2,10,11,12) |
| InChIKey | FZDQDESAHLOHIO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|