C17H25N3 — CID 123338286
N-[amino(cyclohexa-2,4-dien-1-yl)methyl]-N'-(1-cyclohexa-1,5-dien-1-ylethyl)ethanimidamide (PubChem CID 123338286) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-[amino(cyclohexa-2,4-dien-1-yl)methyl]-N'-(1-cyclohexa-1,5-dien-1-ylethyl)ethanimidamide.
| Compound Name | N-[amino(cyclohexa-2,4-dien-1-yl)methyl]-N'-(1-cyclohexa-1,5-dien-1-ylethyl)ethanimidamide |
|---|---|
| PubChem CID | 123338286 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-[amino(cyclohexa-2,4-dien-1-yl)methyl]-N'-(1-cyclohexa-1,5-dien-1-ylethyl)ethanimidamide |
| SMILES | C/C(=N\C(C)C1=CCCC=C1)NC(N)C1C=CC=CC1 |
| InChI | InChI=1S/C17H25N3/c1-13(15-9-5-3-6-10-15)19-14(2)20-17(18)16-11-7-4-8-12-16/h4-5,7-11,13,16-17H,3,6,12,18H2,1-2H3,(H,19,20) |
| InChIKey | NDJRSJGESVBGRF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|