C28H30N4O4S — CID 176542043
2-[(4S)-2,2-dimethyloxan-4-yl]-N-methyl-6-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]-N-phenylthieno[2,3-b]pyrrole-5-carboxamide (PubChem CID 176542043) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyloxan-4-yl]-N-methyl-6-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]-N-phenylthieno[2,3-b]pyrrole-5-carboxamide.
| Compound Name | 2-[(4S)-2,2-dimethyloxan-4-yl]-N-methyl-6-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]-N-phenylthieno[2,3-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 176542043 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 2-[(4S)-2,2-dimethyloxan-4-yl]-N-methyl-6-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]-N-phenylthieno[2,3-b]pyrrole-5-carboxamide |
| SMILES | C[C@H]1C[C@]1(C1=NC(=C=O)ON1)n1c(C(=O)N(C)c2ccccc2)cc2cc([C@H]3CCOC(C)(C)C3)sc21 |
| InChI | InChI=1S/C28H30N4O4S/c1-17-14-28(17,26-29-23(16-33)36-30-26)32-21(24(34)31(4)20-8-6-5-7-9-20)12-19-13-22(37-25(19)32)18-10-11-35-27(2,3)15-18/h5-9,12-13,17-18H,10-11,14-15H2,1-4H3,(H,29,30)/t17-,18-,28-/m0/s1 |
| InChIKey | JAJJWEQVPUCOMH-RAALOAAWSA-N |
| XLogP | 4.99 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|