C24H29N3O7S — CID 176542063
2-[(4S)-2,2-dimethyloxan-4-yl]-6-[(1S,2S)-2-(2-methoxyethoxymethyl)-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]thieno[2,3-b]pyrrole-5-carboxylic acid (PubChem CID 176542063) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyloxan-4-yl]-6-[(1S,2S)-2-(2-methoxyethoxymethyl)-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]thieno[2,3-b]pyrrole-5-carboxylic acid.
| Compound Name | 2-[(4S)-2,2-dimethyloxan-4-yl]-6-[(1S,2S)-2-(2-methoxyethoxymethyl)-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]thieno[2,3-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 176542063 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-[(4S)-2,2-dimethyloxan-4-yl]-6-[(1S,2S)-2-(2-methoxyethoxymethyl)-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]thieno[2,3-b]pyrrole-5-carboxylic acid |
| SMILES | COCCOC[C@H]1C[C@]1(C1=NC(=C=O)ON1)n1c(C(=O)O)cc2cc([C@H]3CCOC(C)(C)C3)sc21 |
| InChI | InChI=1S/C24H29N3O7S/c1-23(2)10-14(4-5-33-23)18-9-15-8-17(21(29)30)27(20(15)35-18)24(22-25-19(12-28)34-26-22)11-16(24)13-32-7-6-31-3/h8-9,14,16H,4-7,10-11,13H2,1-3H3,(H,25,26)(H,29,30)/t14-,16+,24-/m0/s1 |
| InChIKey | LYWOTWFYNFNCDT-RLZCXYDISA-N |
| XLogP | 3.06 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|