C20H22N4OS — CID 176545785
1-[[2-(azepan-2-yl)phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 176545785) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-[[2-(azepan-2-yl)phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 1-[[2-(azepan-2-yl)phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 176545785 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[[2-(azepan-2-yl)phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=C1NC(=C=S)N(Cc2ccccc2C2CCCCCN2)c2cc[nH]c21 |
| InChI | InChI=1S/C20H22N4OS/c25-20-19-17(9-11-22-19)24(18(13-26)23-20)12-14-6-3-4-7-15(14)16-8-2-1-5-10-21-16/h3-4,6-7,9,11,16,21-22H,1-2,5,8,10,12H2,(H,23,25) |
| InChIKey | NLZRTEXXZNLUDI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|