C17H16BrF2NO — CID 176550327
(2-bromo-4,5-difluorophenyl)-[2-(tert-butylamino)phenyl]methanone (PubChem CID 176550327) has the molecular formula C17H16BrF2NO and a molecular weight of 368.22 g/mol. Its IUPAC name is (2-bromo-4,5-difluorophenyl)-[2-(tert-butylamino)phenyl]methanone.
| Compound Name | (2-bromo-4,5-difluorophenyl)-[2-(tert-butylamino)phenyl]methanone |
|---|---|
| PubChem CID | 176550327 |
| Molecular Formula | C17H16BrF2NO |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2-bromo-4,5-difluorophenyl)-[2-(tert-butylamino)phenyl]methanone |
| SMILES | CC(C)(C)Nc1ccccc1C(=O)c1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C17H16BrF2NO/c1-17(2,3)21-15-7-5-4-6-10(15)16(22)11-8-13(19)14(20)9-12(11)18/h4-9,21H,1-3H3 |
| InChIKey | DKOGIAHNSLHQKW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|