C14H5F8NO — CID 89275551
(2,3,4,5,6-pentafluorophenyl)-[2-(trifluoromethylamino)phenyl]methanone (PubChem CID 89275551) has the molecular formula C14H5F8NO and a molecular weight of 355.18 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[2-(trifluoromethylamino)phenyl]methanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[2-(trifluoromethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 89275551 |
| Molecular Formula | C14H5F8NO |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[2-(trifluoromethylamino)phenyl]methanone |
| SMILES | O=C(c1ccccc1NC(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H5F8NO/c15-8-7(9(16)11(18)12(19)10(8)17)13(24)5-3-1-2-4-6(5)23-14(20,21)22/h1-4,23H |
| InChIKey | JVGMTBICWYNDPE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|