C18H14F5NO2 — CID 135058825
N-[2-(2,2-dimethylpropanoyl)phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 135058825) has the molecular formula C18H14F5NO2 and a molecular weight of 371.31 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropanoyl)phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[2-(2,2-dimethylpropanoyl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 135058825 |
| Molecular Formula | C18H14F5NO2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[2-(2,2-dimethylpropanoyl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(C)(C)C(=O)c1ccccc1NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H14F5NO2/c1-18(2,3)16(25)8-6-4-5-7-9(8)24-17(26)10-11(19)13(21)15(23)14(22)12(10)20/h4-7H,1-3H3,(H,24,26) |
| InChIKey | NQZZKQDRWNWILW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|