C16H22BrN3O4S — CID 176550350
tert-butyl 3-[(6-bromo-2-methyl-3-pyridinyl)sulfonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 176550350) has the molecular formula C16H22BrN3O4S and a molecular weight of 432.34 g/mol. Its IUPAC name is tert-butyl 3-[(6-bromo-2-methyl-3-pyridinyl)sulfonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-[(6-bromo-2-methyl-3-pyridinyl)sulfonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 176550350 |
| Molecular Formula | C16H22BrN3O4S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | tert-butyl 3-[(6-bromo-2-methyl-3-pyridinyl)sulfonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | Cc1nc(Br)ccc1S(=O)(=O)C1N(C(=O)OC(C)(C)C)CC12CNC2 |
| InChI | InChI=1S/C16H22BrN3O4S/c1-10-11(5-6-12(17)19-10)25(22,23)13-16(7-18-8-16)9-20(13)14(21)24-15(2,3)4/h5-6,13,18H,7-9H2,1-4H3 |
| InChIKey | BFYHHXIQTWSWKP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|