C18H15Cl2F2N5O2S — CID 176551898
4-[[4-chloro-5-(4-chloro-2-fluoroanilino)-3-pyridinyl]methyl]-3-fluoro-2-(2-methyl-2-sulfinohydrazinyl)pyridine (PubChem CID 176551898) has the molecular formula C18H15Cl2F2N5O2S and a molecular weight of 474.32 g/mol. Its IUPAC name is 4-[[4-chloro-5-(4-chloro-2-fluoroanilino)-3-pyridinyl]methyl]-3-fluoro-2-(2-methyl-2-sulfinohydrazinyl)pyridine.
| Compound Name | 4-[[4-chloro-5-(4-chloro-2-fluoroanilino)-3-pyridinyl]methyl]-3-fluoro-2-(2-methyl-2-sulfinohydrazinyl)pyridine |
|---|---|
| PubChem CID | 176551898 |
| Molecular Formula | C18H15Cl2F2N5O2S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | 4-[[4-chloro-5-(4-chloro-2-fluoroanilino)-3-pyridinyl]methyl]-3-fluoro-2-(2-methyl-2-sulfinohydrazinyl)pyridine |
| SMILES | CN(Nc1nccc(Cc2cncc(Nc3ccc(Cl)cc3F)c2Cl)c1F)S(=O)O |
| InChI | InChI=1S/C18H15Cl2F2N5O2S/c1-27(30(28)29)26-18-17(22)10(4-5-24-18)6-11-8-23-9-15(16(11)20)25-14-3-2-12(19)7-13(14)21/h2-5,7-9,25H,6H2,1H3,(H,24,26)(H,28,29) |
| InChIKey | WNQPSOYEAOQVAC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|