C14H25NS — CID 176552732
ethane;4-(4-ethylcyclohexyl)-5-methyl-1,3-thiazole (PubChem CID 176552732) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is ethane;4-(4-ethylcyclohexyl)-5-methyl-1,3-thiazole.
| Compound Name | ethane;4-(4-ethylcyclohexyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 176552732 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | ethane;4-(4-ethylcyclohexyl)-5-methyl-1,3-thiazole |
| SMILES | CC.CCC1CCC(c2ncsc2C)CC1 |
| InChI | InChI=1S/C12H19NS.C2H6/c1-3-10-4-6-11(7-5-10)12-9(2)14-8-13-12;1-2/h8,10-11H,3-7H2,1-2H3;1-2H3 |
| InChIKey | XTUMRYZRZDVSMM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |