C14H24N4O5 — CID 176553771
(E,2R)-2-amino-7-[[4-(carboxymethyl)piperazine-1-carbonyl]amino]hept-3-enoic acid (PubChem CID 176553771) has the molecular formula C14H24N4O5 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E,2R)-2-amino-7-[[4-(carboxymethyl)piperazine-1-carbonyl]amino]hept-3-enoic acid.
| Compound Name | (E,2R)-2-amino-7-[[4-(carboxymethyl)piperazine-1-carbonyl]amino]hept-3-enoic acid |
|---|---|
| PubChem CID | 176553771 |
| Molecular Formula | C14H24N4O5 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (E,2R)-2-amino-7-[[4-(carboxymethyl)piperazine-1-carbonyl]amino]hept-3-enoic acid |
| SMILES | N[C@H](/C=C/CCCNC(=O)N1CCN(CC(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C14H24N4O5/c15-11(13(21)22)4-2-1-3-5-16-14(23)18-8-6-17(7-9-18)10-12(19)20/h2,4,11H,1,3,5-10,15H2,(H,16,23)(H,19,20)(H,21,22)/b4-2+/t11-/m1/s1 |
| InChIKey | MFNQTSOWUZGZHW-JRBALWBOSA-N |
| XLogP | -0.85 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|