C31H34N4O8 — CID 176554457
4-O-tert-butyl 1-O-[(19S)-19-ethyl-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl] piperazine-1,4-dicarboxylate (PubChem CID 176554457) has the molecular formula C31H34N4O8 and a molecular weight of 590.63 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(19S)-19-ethyl-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl] piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-[(19S)-19-ethyl-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl] piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 176554457 |
| Molecular Formula | C31H34N4O8 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(19S)-19-ethyl-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl] piperazine-1,4-dicarboxylate |
| SMILES | CC[C@@]1(OC(=O)N2CCN(C(=O)OC(C)(C)C)CC2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OC)ccc3nc2-1 |
| InChI | InChI=1S/C31H34N4O8/c1-6-31(43-29(39)34-11-9-33(10-12-34)28(38)42-30(2,3)4)22-15-24-25-19(13-18-14-20(40-5)7-8-23(18)32-25)16-35(24)26(36)21(22)17-41-27(31)37/h7-8,13-15H,6,9-12,16-17H2,1-5H3/t31-/m0/s1 |
| InChIKey | LNRHBXXYKLUUNF-HKBQPEDESA-N |
| XLogP | 3.79 |
| TPSA | 129.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|