C23H26BN3O3 — CID 176556638
[1-[8-(3-cyano-8-methoxyquinolin-4-yl)-8-azabicyclo[3.2.1]oct-2-en-3-yl]cyclobutyl]methylboronic acid (PubChem CID 176556638) has the molecular formula C23H26BN3O3 and a molecular weight of 403.29 g/mol. Its IUPAC name is [1-[8-(3-cyano-8-methoxyquinolin-4-yl)-8-azabicyclo[3.2.1]oct-2-en-3-yl]cyclobutyl]methylboronic acid.
| Compound Name | [1-[8-(3-cyano-8-methoxyquinolin-4-yl)-8-azabicyclo[3.2.1]oct-2-en-3-yl]cyclobutyl]methylboronic acid |
|---|---|
| PubChem CID | 176556638 |
| Molecular Formula | C23H26BN3O3 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [1-[8-(3-cyano-8-methoxyquinolin-4-yl)-8-azabicyclo[3.2.1]oct-2-en-3-yl]cyclobutyl]methylboronic acid |
| SMILES | COc1cccc2c(N3C4C=C(C5(CB(O)O)CCC5)CC3CC4)c(C#N)cnc12 |
| InChI | InChI=1S/C23H26BN3O3/c1-30-20-5-2-4-19-21(20)26-13-15(12-25)22(19)27-17-6-7-18(27)11-16(10-17)23(8-3-9-23)14-24(28)29/h2,4-5,10,13,17-18,28-29H,3,6-9,11,14H2,1H3 |
| InChIKey | HIRKBOBGMWKIGV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|