C17H20N2O4 — CID 176557023
1,4-dioxane;2-methoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 176557023) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1,4-dioxane;2-methoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 1,4-dioxane;2-methoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 176557023 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1,4-dioxane;2-methoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | C1COCCO1.COc1cc2n(c(=O)n1)CCc1ccccc1-2 |
| InChI | InChI=1S/C13H12N2O2.C4H8O2/c1-17-12-8-11-10-5-3-2-4-9(10)6-7-15(11)13(16)14-12;1-2-6-4-3-5-1/h2-5,8H,6-7H2,1H3;1-4H2 |
| InChIKey | PHNYDEBSYLDXSS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |