C15H19N3O2 — CID 176559593
3-[(1,3-dimethylindol-6-yl)-formylamino]-N-methylpropanamide (PubChem CID 176559593) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[(1,3-dimethylindol-6-yl)-formylamino]-N-methylpropanamide.
| Compound Name | 3-[(1,3-dimethylindol-6-yl)-formylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 176559593 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[(1,3-dimethylindol-6-yl)-formylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C=O)c1ccc2c(C)cn(C)c2c1 |
| InChI | InChI=1S/C15H19N3O2/c1-11-9-17(3)14-8-12(4-5-13(11)14)18(10-19)7-6-15(20)16-2/h4-5,8-10H,6-7H2,1-3H3,(H,16,20) |
| InChIKey | FBVSJGVYXDLMFW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|