C15H21N — CID 176559687
3-methyl-1,5-di(propan-2-yl)indole (PubChem CID 176559687) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-methyl-1,5-di(propan-2-yl)indole.
| Compound Name | 3-methyl-1,5-di(propan-2-yl)indole |
|---|---|
| PubChem CID | 176559687 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-methyl-1,5-di(propan-2-yl)indole |
| SMILES | Cc1cn(C(C)C)c2ccc(C(C)C)cc12 |
| InChI | InChI=1S/C15H21N/c1-10(2)13-6-7-15-14(8-13)12(5)9-16(15)11(3)4/h6-11H,1-5H3 |
| InChIKey | SHRLAYCXGGJSGW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |