C22H26N2O2 — CID 87383896
4-[1-(3,5-dimethylindol-1-yl)-2,2-dimethylpropyl]-N-hydroxybenzamide (PubChem CID 87383896) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[1-(3,5-dimethylindol-1-yl)-2,2-dimethylpropyl]-N-hydroxybenzamide.
| Compound Name | 4-[1-(3,5-dimethylindol-1-yl)-2,2-dimethylpropyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87383896 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-[1-(3,5-dimethylindol-1-yl)-2,2-dimethylpropyl]-N-hydroxybenzamide |
| SMILES | Cc1ccc2c(c1)c(C)cn2C(c1ccc(C(=O)NO)cc1)C(C)(C)C |
| InChI | InChI=1S/C22H26N2O2/c1-14-6-11-19-18(12-14)15(2)13-24(19)20(22(3,4)5)16-7-9-17(10-8-16)21(25)23-26/h6-13,20,26H,1-5H3,(H,23,25) |
| InChIKey | KAPFTDDXPIKABW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|