C19H25N3O3 — CID 58417460
N-[1-[4-(hydroxycarbamoyl)phenyl]-2,2-dimethylpropyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 58417460) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)phenyl]-2,2-dimethylpropyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)phenyl]-2,2-dimethylpropyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58417460 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)phenyl]-2,2-dimethylpropyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(c2ccc(C(=O)NO)cc2)C(C)(C)C)c(C)[nH]1 |
| InChI | InChI=1S/C19H25N3O3/c1-11-10-15(12(2)20-11)18(24)21-16(19(3,4)5)13-6-8-14(9-7-13)17(23)22-25/h6-10,16,20,25H,1-5H3,(H,21,24)(H,22,23) |
| InChIKey | YCMBZSFVNSHLCM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|