C15H15N3O2 — CID 176559772
1-(1-ethylisoquinolin-5-yl)-1,3-diazinane-2,4-dione (PubChem CID 176559772) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(1-ethylisoquinolin-5-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1-ethylisoquinolin-5-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 176559772 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(1-ethylisoquinolin-5-yl)-1,3-diazinane-2,4-dione |
| SMILES | CCc1nccc2c(N3CCC(=O)NC3=O)cccc12 |
| InChI | InChI=1S/C15H15N3O2/c1-2-12-10-4-3-5-13(11(10)6-8-16-12)18-9-7-14(19)17-15(18)20/h3-6,8H,2,7,9H2,1H3,(H,17,19,20) |
| InChIKey | GULPTGABLNZCLI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |