C12H12Br2N2O2 — CID 176562159
5-bromo-1-[2-(bromomethyl)-1,3-dioxan-5-yl]pyrrolo[2,3-b]pyridine (PubChem CID 176562159) has the molecular formula C12H12Br2N2O2 and a molecular weight of 376.05 g/mol. Its IUPAC name is 5-bromo-1-[2-(bromomethyl)-1,3-dioxan-5-yl]pyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-1-[2-(bromomethyl)-1,3-dioxan-5-yl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 176562159 |
| Molecular Formula | C12H12Br2N2O2 |
| Molecular Weight | 376.05 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 5-bromo-1-[2-(bromomethyl)-1,3-dioxan-5-yl]pyrrolo[2,3-b]pyridine |
| SMILES | BrCC1OCC(n2ccc3cc(Br)cnc32)CO1 |
| InChI | InChI=1S/C12H12Br2N2O2/c13-4-11-17-6-10(7-18-11)16-2-1-8-3-9(14)5-15-12(8)16/h1-3,5,10-11H,4,6-7H2 |
| InChIKey | VGYBQVVBVWAWAW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.05 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|