C16H23NO3 — CID 176562196
ethyl 2,5-dimethyl-4-[(2R,5R)-5-methylmorpholin-2-yl]benzoate (PubChem CID 176562196) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-4-[(2R,5R)-5-methylmorpholin-2-yl]benzoate.
| Compound Name | ethyl 2,5-dimethyl-4-[(2R,5R)-5-methylmorpholin-2-yl]benzoate |
|---|---|
| PubChem CID | 176562196 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl 2,5-dimethyl-4-[(2R,5R)-5-methylmorpholin-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(C)c([C@@H]2CN[C@H](C)CO2)cc1C |
| InChI | InChI=1S/C16H23NO3/c1-5-19-16(18)14-7-10(2)13(6-11(14)3)15-8-17-12(4)9-20-15/h6-7,12,15,17H,5,8-9H2,1-4H3/t12-,15+/m1/s1 |
| InChIKey | VTRBGDKYLIBDLD-DOMZBBRYSA-N |
| XLogP | 2.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |