C35H43F2N5O3 — CID 176562389
N-[1-cyclobutyl-7-fluoro-3-[1-[[4-fluoro-1-(3-methylbenzoyl)piperidin-4-yl]methyl]piperidin-4-yl]indol-6-yl]-3-formamidopropanamide (PubChem CID 176562389) has the molecular formula C35H43F2N5O3 and a molecular weight of 619.76 g/mol. Its IUPAC name is N-[1-cyclobutyl-7-fluoro-3-[1-[[4-fluoro-1-(3-methylbenzoyl)piperidin-4-yl]methyl]piperidin-4-yl]indol-6-yl]-3-formamidopropanamide.
| Compound Name | N-[1-cyclobutyl-7-fluoro-3-[1-[[4-fluoro-1-(3-methylbenzoyl)piperidin-4-yl]methyl]piperidin-4-yl]indol-6-yl]-3-formamidopropanamide |
|---|---|
| PubChem CID | 176562389 |
| Molecular Formula | C35H43F2N5O3 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | N-[1-cyclobutyl-7-fluoro-3-[1-[[4-fluoro-1-(3-methylbenzoyl)piperidin-4-yl]methyl]piperidin-4-yl]indol-6-yl]-3-formamidopropanamide |
| SMILES | Cc1cccc(C(=O)N2CCC(F)(CN3CCC(c4cn(C5CCC5)c5c(F)c(NC(=O)CCNC=O)ccc45)CC3)CC2)c1 |
| InChI | InChI=1S/C35H43F2N5O3/c1-24-4-2-5-26(20-24)34(45)41-18-13-35(37,14-19-41)22-40-16-11-25(12-17-40)29-21-42(27-6-3-7-27)33-28(29)8-9-30(32(33)36)39-31(44)10-15-38-23-43/h2,4-5,8-9,20-21,23,25,27H,3,6-7,10-19,22H2,1H3,(H,38,43)(H,39,44) |
| InChIKey | ZFDAISLVBWWSJN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|