C17H23ClN4O3 — CID 176563138
methyl 4-[5-methyl-4-[(3E)-1,1,4-triamino-4-chlorobuta-1,3-dien-2-yl]morpholin-2-yl]benzoate (PubChem CID 176563138) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is methyl 4-[5-methyl-4-[(3E)-1,1,4-triamino-4-chlorobuta-1,3-dien-2-yl]morpholin-2-yl]benzoate.
| Compound Name | methyl 4-[5-methyl-4-[(3E)-1,1,4-triamino-4-chlorobuta-1,3-dien-2-yl]morpholin-2-yl]benzoate |
|---|---|
| PubChem CID | 176563138 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | methyl 4-[5-methyl-4-[(3E)-1,1,4-triamino-4-chlorobuta-1,3-dien-2-yl]morpholin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CN(C(/C=C(\N)Cl)=C(N)N)C(C)CO2)cc1 |
| InChI | InChI=1S/C17H23ClN4O3/c1-10-9-25-14(8-22(10)13(16(20)21)7-15(18)19)11-3-5-12(6-4-11)17(23)24-2/h3-7,10,14H,8-9,19-21H2,1-2H3/b15-7- |
| InChIKey | XROCADGNXLYFQI-CHHVJCJISA-N |
| XLogP | 1.36 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|