C11H11BrFNO2 — CID 176563812
2-(5-bromo-4-fluoroindol-1-yl)propane-1,3-diol (PubChem CID 176563812) has the molecular formula C11H11BrFNO2 and a molecular weight of 288.12 g/mol. Its IUPAC name is 2-(5-bromo-4-fluoroindol-1-yl)propane-1,3-diol.
| Compound Name | 2-(5-bromo-4-fluoroindol-1-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 176563812 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-(5-bromo-4-fluoroindol-1-yl)propane-1,3-diol |
| SMILES | OCC(CO)n1ccc2c(F)c(Br)ccc21 |
| InChI | InChI=1S/C11H11BrFNO2/c12-9-1-2-10-8(11(9)13)3-4-14(10)7(5-15)6-16/h1-4,7,15-16H,5-6H2 |
| InChIKey | GZBWLQJPEDQCFM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |