C12H16N2O3S — CID 176564069
3-(2,2-dioxo-2λ6-thia-6-azaspiro[3.3]heptan-6-yl)-2-methoxyaniline (PubChem CID 176564069) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-(2,2-dioxo-2λ6-thia-6-azaspiro[3.3]heptan-6-yl)-2-methoxyaniline.
| Compound Name | 3-(2,2-dioxo-2λ6-thia-6-azaspiro[3.3]heptan-6-yl)-2-methoxyaniline |
|---|---|
| PubChem CID | 176564069 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-(2,2-dioxo-2λ6-thia-6-azaspiro[3.3]heptan-6-yl)-2-methoxyaniline |
| SMILES | COc1c(N)cccc1N1CC2(C1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C12H16N2O3S/c1-17-11-9(13)3-2-4-10(11)14-5-12(6-14)7-18(15,16)8-12/h2-4H,5-8,13H2,1H3 |
| InChIKey | LAIDPNNXAYALIF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|