C14H27N3O — CID 176566621
ethane;3-ethanimidoyl-2-methoxy-N,6-dimethylpyridin-4-amine (PubChem CID 176566621) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;3-ethanimidoyl-2-methoxy-N,6-dimethylpyridin-4-amine.
| Compound Name | ethane;3-ethanimidoyl-2-methoxy-N,6-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 176566621 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | ethane;3-ethanimidoyl-2-methoxy-N,6-dimethylpyridin-4-amine |
| SMILES | CC.CC.[H]/N=C(\C)c1c(NC)cc(C)nc1OC |
| InChI | InChI=1S/C10H15N3O.2C2H6/c1-6-5-8(12-3)9(7(2)11)10(13-6)14-4;2*1-2/h5,11H,1-4H3,(H,12,13);2*1-2H3/b11-7+;; |
| InChIKey | GNGZRRIEEGUINH-FCVAESPPSA-N |
| XLogP | 3.88 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|