C10H20FNO — CID 176567903
ethane;1-[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]ethanone (PubChem CID 176567903) has the molecular formula C10H20FNO and a molecular weight of 189.27 g/mol. Its IUPAC name is ethane;1-[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]ethanone.
| Compound Name | ethane;1-[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 176567903 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | ethane;1-[(2S,4S)-1-ethyl-4-fluoropyrrolidin-2-yl]ethanone |
| SMILES | CC.CCN1C[C@@H](F)C[C@H]1C(C)=O |
| InChI | InChI=1S/C8H14FNO.C2H6/c1-3-10-5-7(9)4-8(10)6(2)11;1-2/h7-8H,3-5H2,1-2H3;1-2H3/t7-,8-;/m0./s1 |
| InChIKey | XMOIZIDLZFZMIX-WSZWBAFRSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |