C10H14N2 — CID 176568724
7-ethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-4-amine (PubChem CID 176568724) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 7-ethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-4-amine.
| Compound Name | 7-ethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-4-amine |
|---|---|
| PubChem CID | 176568724 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 7-ethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-4-amine |
| SMILES | CCC1CCc2c(N)cncc21 |
| InChI | InChI=1S/C10H14N2/c1-2-7-3-4-8-9(7)5-12-6-10(8)11/h5-7H,2-4,11H2,1H3 |
| InChIKey | LVSQOVLREYFOQS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |