C8H13F2N3 — CID 176568753
N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-N-methylethanamine (PubChem CID 176568753) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-N-methylethanamine.
| Compound Name | N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 176568753 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | N-[[2-(difluoromethyl)pyrazol-3-yl]methyl]-N-methylethanamine |
| SMILES | CCN(C)Cc1ccnn1C(F)F |
| InChI | InChI=1S/C8H13F2N3/c1-3-12(2)6-7-4-5-11-13(7)8(9)10/h4-5,8H,3,6H2,1-2H3 |
| InChIKey | XUDXKKWRQLQVGL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |