C9H14F2N2O — CID 122170927
1-(difluoromethyl)-5-(2-methylpropoxymethyl)pyrazole (PubChem CID 122170927) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-(difluoromethyl)-5-(2-methylpropoxymethyl)pyrazole.
| Compound Name | 1-(difluoromethyl)-5-(2-methylpropoxymethyl)pyrazole |
|---|---|
| PubChem CID | 122170927 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1-(difluoromethyl)-5-(2-methylpropoxymethyl)pyrazole |
| SMILES | CC(C)COCc1ccnn1C(F)F |
| InChI | InChI=1S/C9H14F2N2O/c1-7(2)5-14-6-8-3-4-12-13(8)9(10)11/h3-4,7,9H,5-6H2,1-2H3 |
| InChIKey | PXZREFNKYZCGPG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |