C13H26FN3 — CID 176569412
2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-fluoro-N-methylpentan-1-amine (PubChem CID 176569412) has the molecular formula C13H26FN3 and a molecular weight of 243.37 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-fluoro-N-methylpentan-1-amine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-fluoro-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 176569412 |
| Molecular Formula | C13H26FN3 |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-fluoro-N-methylpentan-1-amine |
| SMILES | CCCC(CN(C)F)C1CNC2NCCCC21 |
| InChI | InChI=1S/C13H26FN3/c1-3-5-10(9-17(2)14)12-8-16-13-11(12)6-4-7-15-13/h10-13,15-16H,3-9H2,1-2H3 |
| InChIKey | WNWXEAYNNYTLDA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|