C16H29FN2 — CID 176569522
3-[(6R)-1-ethyl-6-methylpiperidin-3-yl]-6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 176569522) has the molecular formula C16H29FN2 and a molecular weight of 268.42 g/mol. Its IUPAC name is 3-[(6R)-1-ethyl-6-methylpiperidin-3-yl]-6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 3-[(6R)-1-ethyl-6-methylpiperidin-3-yl]-6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 176569522 |
| Molecular Formula | C16H29FN2 |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 3-[(6R)-1-ethyl-6-methylpiperidin-3-yl]-6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | CCN1CC(C2CNC3CC(F)CCC32)CC[C@H]1C |
| InChI | InChI=1S/C16H29FN2/c1-3-19-10-12(5-4-11(19)2)15-9-18-16-8-13(17)6-7-14(15)16/h11-16,18H,3-10H2,1-2H3/t11-,12?,13?,14?,15?,16?/m1/s1 |
| InChIKey | KMZKNIQEEUNRLB-WFWUXJIDSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |