C11H16N2O — CID 176569868
ethane;(3-methyl-2,1-benzoxazol-7-yl)methanamine (PubChem CID 176569868) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;(3-methyl-2,1-benzoxazol-7-yl)methanamine.
| Compound Name | ethane;(3-methyl-2,1-benzoxazol-7-yl)methanamine |
|---|---|
| PubChem CID | 176569868 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;(3-methyl-2,1-benzoxazol-7-yl)methanamine |
| SMILES | CC.Cc1onc2c(CN)cccc12 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-6-8-4-2-3-7(5-10)9(8)11-12-6;1-2/h2-4H,5,10H2,1H3;1-2H3 |
| InChIKey | FSRBRFLWXXEAKP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |