About 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine
2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine (PubChem CID 82410494) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine.
Analyze 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine?
The IUPAC name of 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine (CID 82410494) is 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine.
What is the SMILES notation for 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine?
The canonical SMILES for 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine is Cc1onc2c(CCN)nccc12.
What is the InChIKey of 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine?
The InChIKey is IPULXHNMVGRVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6-7-3-5-11-8(2-4-10)9(7)12-13-6/h3,5H,2,4,10H2,1H3.
What are the key properties of 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine?
2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine has a molecular weight of 177.21 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-[1,2]oxazolo[3,4-c]pyridin-7-yl)ethanamine is sourced from PubChem (CID 82410494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).