About 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine
2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine (PubChem CID 82597080) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine |
| PubChem CID | 82597080 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine |
| SMILES | NCCc1nccc2c1OCO2 |
| InChI | InChI=1S/C8H10N2O2/c9-3-1-6-8-7(2-4-10-6)11-5-12-8/h2,4H,1,3,5,9H2 |
| InChIKey | UOEWHBXRYRIVLX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine?
The IUPAC name of 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine (CID 82597080) is 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine.
What is the SMILES notation for 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine?
The canonical SMILES for 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine is NCCc1nccc2c1OCO2.
What is the InChIKey of 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine?
The InChIKey is UOEWHBXRYRIVLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c9-3-1-6-8-7(2-4-10-6)11-5-12-8/h2,4H,1,3,5,9H2.
What are the key properties of 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine?
2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine has a molecular weight of 166.18 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,3]dioxolo[4,5-c]pyridin-4-yl)ethanamine is sourced from PubChem (CID 82597080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).