C13H21NOS — CID 176569889
ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol (PubChem CID 176569889) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol.
| Compound Name | ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol |
|---|---|
| PubChem CID | 176569889 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol |
| SMILES | CC.CC.Cc1snc2ccc(CO)cc12 |
| InChI | InChI=1S/C9H9NOS.2C2H6/c1-6-8-4-7(5-11)2-3-9(8)10-12-6;2*1-2/h2-4,11H,5H2,1H3;2*1-2H3 |
| InChIKey | RPSIBSHJMIMPSY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |