About ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol
ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol (PubChem CID 176569889) has the molecular formula C13H21NOS
and a molecular weight of 239.38 g/mol. Its IUPAC name is ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol.
Molecular Properties
| Compound Name | ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol |
| PubChem CID | 176569889 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol |
| SMILES | CC.CC.Cc1snc2ccc(CO)cc12 |
| InChI | InChI=1S/C9H9NOS.2C2H6/c1-6-8-4-7(5-11)2-3-9(8)10-12-6;2*1-2/h2-4,11H,5H2,1H3;2*1-2H3 |
| InChIKey | RPSIBSHJMIMPSY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol?
The IUPAC name of ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol (CID 176569889) is ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol.
What is the SMILES notation for ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol?
The canonical SMILES for ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol is CC.CC.Cc1snc2ccc(CO)cc12.
What is the InChIKey of ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol?
The InChIKey is RPSIBSHJMIMPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS.2C2H6/c1-6-8-4-7(5-11)2-3-9(8)10-12-6;2*1-2/h2-4,11H,5H2,1H3;2*1-2H3.
What are the key properties of ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol?
ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol has a molecular weight of 239.38 g/mol, XLogP of 4.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3-methyl-2,1-benzothiazol-5-yl)methanol is sourced from PubChem (CID 176569889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).