C10H7ClFN3O — CID 176572195
2-chloro-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 176572195) has the molecular formula C10H7ClFN3O and a molecular weight of 239.64 g/mol. Its IUPAC name is 2-chloro-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-chloro-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 176572195 |
| Molecular Formula | C10H7ClFN3O |
| Molecular Weight | 239.64 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-chloro-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(Cl)nc3cc(F)cc1c32 |
| InChI | InChI=1S/C10H7ClFN3O/c11-10-14-7-4-5(12)3-6-8(7)15(10)2-1-13-9(6)16/h3-4H,1-2H2,(H,13,16) |
| InChIKey | RUPHOSRTNFGXFC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.64 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |