C16H13FN2O2 — CID 73335802
8-fluoro-6-(furan-2-yl)-10-methyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 73335802) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 8-fluoro-6-(furan-2-yl)-10-methyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
| Compound Name | 8-fluoro-6-(furan-2-yl)-10-methyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 73335802 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 8-fluoro-6-(furan-2-yl)-10-methyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | Cc1c2n(c3c(-c4ccco4)cc(F)cc13)CCNC2=O |
| InChI | InChI=1S/C16H13FN2O2/c1-9-11-7-10(17)8-12(13-3-2-6-21-13)15(11)19-5-4-18-16(20)14(9)19/h2-3,6-8H,4-5H2,1H3,(H,18,20) |
| InChIKey | KIBQYSLTXBVHLY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|