C20H19N5O — CID 144567907
11-methyl-7-[6-(methylamino)-3-pyridinyl]-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile (PubChem CID 144567907) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 11-methyl-7-[6-(methylamino)-3-pyridinyl]-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile.
| Compound Name | 11-methyl-7-[6-(methylamino)-3-pyridinyl]-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile |
|---|---|
| PubChem CID | 144567907 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 11-methyl-7-[6-(methylamino)-3-pyridinyl]-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile |
| SMILES | CNc1ccc(-c2cc(C#N)cc3c(C)c4n(c23)CCCNC4=O)cn1 |
| InChI | InChI=1S/C20H19N5O/c1-12-15-8-13(10-21)9-16(14-4-5-17(22-2)24-11-14)19(15)25-7-3-6-23-20(26)18(12)25/h4-5,8-9,11H,3,6-7H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | NKSAJOSHEJMHRK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|