C20H18ClN3O — CID 163878252
7-(4-chlorophenyl)-1-hydroxy-11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole-9-carbonitrile (PubChem CID 163878252) has the molecular formula C20H18ClN3O and a molecular weight of 351.84 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-1-hydroxy-11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole-9-carbonitrile.
| Compound Name | 7-(4-chlorophenyl)-1-hydroxy-11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole-9-carbonitrile |
|---|---|
| PubChem CID | 163878252 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 7-(4-chlorophenyl)-1-hydroxy-11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole-9-carbonitrile |
| SMILES | Cc1c2n(c3c(-c4ccc(Cl)cc4)cc(C#N)cc13)CCCNC2O |
| InChI | InChI=1S/C20H18ClN3O/c1-12-16-9-13(11-22)10-17(14-3-5-15(21)6-4-14)19(16)24-8-2-7-23-20(25)18(12)24/h3-6,9-10,20,23,25H,2,7-8H2,1H3 |
| InChIKey | PQUNNSCKSPGZQR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|