About tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen
tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen (PubChem CID 176577937) has the molecular formula C24H32FNO3
and a molecular weight of 401.52 g/mol. Its IUPAC name is tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen |
| PubChem CID | 176577937 |
| Molecular Formula | C24H32FNO3 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen |
| SMILES | CCc1cccc(-c2cc(F)c(C(=O)C(C)CC)c(NC(=O)OC(C)(C)C)c2)c1.[H][H] |
| InChI | InChI=1S/C24H30FNO3.H2/c1-7-15(3)22(27)21-19(25)13-18(17-11-9-10-16(8-2)12-17)14-20(21)26-23(28)29-24(4,5)6;/h9-15H,7-8H2,1-6H3,(H,26,28);1H |
| InChIKey | SZNDCRJEMKOIMV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen?
The IUPAC name of tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen (CID 176577937) is tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen.
What is the SMILES notation for tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen?
The canonical SMILES for tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen is CCc1cccc(-c2cc(F)c(C(=O)C(C)CC)c(NC(=O)OC(C)(C)C)c2)c1.[H][H].
What is the InChIKey of tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen?
The InChIKey is SZNDCRJEMKOIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30FNO3.H2/c1-7-15(3)22(27)21-19(25)13-18(17-11-9-10-16(8-2)12-17)14-20(21)26-23(28)29-24(4,5)6;/h9-15H,7-8H2,1-6H3,(H,26,28);1H.
What are the key properties of tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen?
tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen has a molecular weight of 401.52 g/mol, XLogP of 6.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-(3-ethylphenyl)-3-fluoro-2-(2-methylbutanoyl)phenyl]carbamate;molecular hydrogen is sourced from PubChem (CID 176577937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).