C29H45NO5 — CID 176585127
4-[10,13-dimethyl-3-(trioxidanyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-prop-2-ynoxyethyl)pentanamide (PubChem CID 176585127) has the molecular formula C29H45NO5 and a molecular weight of 487.68 g/mol. Its IUPAC name is 4-[10,13-dimethyl-3-(trioxidanyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-prop-2-ynoxyethyl)pentanamide.
| Compound Name | 4-[10,13-dimethyl-3-(trioxidanyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-prop-2-ynoxyethyl)pentanamide |
|---|---|
| PubChem CID | 176585127 |
| Molecular Formula | C29H45NO5 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | 4-[10,13-dimethyl-3-(trioxidanyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-prop-2-ynoxyethyl)pentanamide |
| SMILES | C#CCOCCNC(=O)CCC(C)C1CCC2C3CC=C4CC(OOO)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H45NO5/c1-5-17-33-18-16-30-27(31)11-6-20(2)24-9-10-25-23-8-7-21-19-22(34-35-32)12-14-28(21,3)26(23)13-15-29(24,25)4/h1,7,20,22-26,32H,6,8-19H2,2-4H3,(H,30,31) |
| InChIKey | TZGMKFOKMPTEGT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|